![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Computer Based Numer..> | 2022-03-11 10:36 | 1.3M | |
| Data Structure Using..> | 2022-03-11 10:36 | 1.5M | |
| Digital Logic Design..> | 2022-03-11 10:36 | 1.1M | |
| Discrete Structure a..> | 2022-03-11 10:36 | 2.1M | |
| Human Values and Pro..> | 2022-03-11 10:35 | 1.1M | |
| Industrial Psycholog..> | 2022-03-11 10:35 | 693K | |
| Introduction to Soft..> | 2022-03-11 10:35 | 1.2M | |
| Mathematics III NAS-..> | 2022-03-11 10:34 | 1.5M | |