![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Mathematics III NAS-..> | 2022-03-09 12:16 | 1.5M | |
| Laser System and App..> | 2022-03-09 12:17 | 754K | |
| Industrial Sociology..> | 2022-03-09 12:17 | 874K | |
| Human Values and Pro..> | 2022-03-09 12:18 | 1.1M | |
| Discrete Structure a..> | 2022-03-09 12:18 | 2.1M | |
| Digital Logic Design..> | 2022-03-09 12:18 | 1.1M | |
| Data Structure Using..> | 2022-03-09 12:18 | 1.5M | |
| Computer Based Numer..> | 2022-03-09 12:18 | 1.3M | |